Products 65037-18-5

CAS 65037-18-5 is the registry number for Ethyl 4-(2-bromophenyl)-2,4-dioxobutanoate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 4-(2-bromophenyl)-2,4-dioxobutanoate (CAS 65037-18-5) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: ethyl 4-(2-bromophenyl)-2,4-dioxobutanoate. InChIKey: SCEZOPORRBNIEH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11BrO4
Molecular weight299.12 g/mol
IUPAC nameethyl 4-(2-bromophenyl)-2,4-dioxobutanoate
InChIKeySCEZOPORRBNIEH-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC=CC=C1Br

Computed by PubChem (NCBI)