cas: 86-90-8 — see every product listed under this CAS number, including other names
4-Bromophthalic Anhydride, >97.0%(GC) (CAS 86-90-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1693-25G |
| cas | 86-90-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 152.77 Pln | |
| TCI | 500g | 2626.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
5-bromo-2-benzofuran-1,3-dione (CAS 86-90-8) is a chemical compound with the molecular formula C8H3BrO3 and a molecular weight of 227.01 g/mol. IUPAC name: 5-bromo-2-benzofuran-1,3-dione. InChIKey: BCKVHOUUJMYIAN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrO3 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 5-bromo-2-benzofuran-1,3-dione |
| InChIKey | BCKVHOUUJMYIAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC2=O |
Computed by PubChem (NCBI)