cas: 86-90-8 — see every product listed under this CAS number, including other names
5-Bromoisobenzofuran-1,3-dione 97% (CAS 86-90-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A281493-25g |
| cas | 86-90-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 242.44 Pln | |
| Ambeed | 500g | 904.38 Pln | |
| Ambeed | 1000g | 1627.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A281493 |
5-bromo-2-benzofuran-1,3-dione (CAS 86-90-8) is a chemical compound with the molecular formula C8H3BrO3 and a molecular weight of 227.01 g/mol. IUPAC name: 5-bromo-2-benzofuran-1,3-dione. InChIKey: BCKVHOUUJMYIAN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrO3 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 5-bromo-2-benzofuran-1,3-dione |
| InChIKey | BCKVHOUUJMYIAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC2=O |
Computed by PubChem (NCBI)