cas: 86-90-8 — see every product listed under this CAS number, including other names
4-Bromophthalic anhydride, 98%, 98% (CAS 86-90-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 50g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149DS-5g |
| cas | 86-90-8 |
| size | 5g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 179.60 Pln | |
| Chemat | 500g | 720.00 Pln | |
| Chemat | 50g | 141.20 Pln | |
| Chemat | 1kg | 1341.20 Pln | |
| Chemat | 5kg | 5635.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-benzofuran-1,3-dione (CAS 86-90-8) is a chemical compound with the molecular formula C8H3BrO3 and a molecular weight of 227.01 g/mol. IUPAC name: 5-bromo-2-benzofuran-1,3-dione. InChIKey: BCKVHOUUJMYIAN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrO3 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 5-bromo-2-benzofuran-1,3-dione |
| InChIKey | BCKVHOUUJMYIAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC2=O |
Computed by PubChem (NCBI)