cas: 86-90-8 — see every product listed under this CAS number, including other names
4-Bromophthalic anhydride, 97% (CAS 86-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 1g, 10g, 1kg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-4020-100g |
| cas | 86-90-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 221.81 Pln | |
| Fluorochem | 500g | 862.21 Pln | |
| Fluorochem | 1kg | 1513.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-bromo-2-benzofuran-1,3-dione (CAS 86-90-8) is a chemical compound with the molecular formula C8H3BrO3 and a molecular weight of 227.01 g/mol. IUPAC name: 5-bromo-2-benzofuran-1,3-dione. InChIKey: BCKVHOUUJMYIAN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrO3 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 5-bromo-2-benzofuran-1,3-dione |
| InChIKey | BCKVHOUUJMYIAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC2=O |
Computed by PubChem (NCBI)