cas: 354574-59-7 — see every product listed under this CAS number, including other names
4-Bromoquinazoline, 95% (CAS 354574-59-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-8315-10g |
| cas | 354574-59-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1934.75 Pln | |
| Fluorochem | 10g | 3798.68 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromoquinazoline (CAS 354574-59-7) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 4-bromoquinazoline. InChIKey: WJYKTNSYMVJDBR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 4-bromoquinazoline |
| InChIKey | WJYKTNSYMVJDBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)Br |
Computed by PubChem (NCBI)