cas: 354574-59-7 — see every product listed under this CAS number, including other names
4-Bromoquinazoline, 97%, 97% (CAS 354574-59-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CIRC-100mg |
| cas | 354574-59-7 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1826.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromoquinazoline (CAS 354574-59-7) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 4-bromoquinazoline. InChIKey: WJYKTNSYMVJDBR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 4-bromoquinazoline |
| InChIKey | WJYKTNSYMVJDBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)Br |
Computed by PubChem (NCBI)