cas: 845551-43-1 — see every product listed under this CAS number, including other names
4-Butoxy-2-methylphenylboronic acid, 97%, 97% (CAS 845551-43-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L2B-250mg |
| cas | 845551-43-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 875.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-butoxy-2-methylphenyl)boronic acid (CAS 845551-43-1) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (4-butoxy-2-methylphenyl)boronic acid. InChIKey: CSHDCDLMFFZDJB-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (4-butoxy-2-methylphenyl)boronic acid |
| InChIKey | CSHDCDLMFFZDJB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCCCC)C)(O)O |
Computed by PubChem (NCBI)