cas: 105365-51-3 — see every product listed under this CAS number, including other names
4-Butoxyphenylboronic Acid (contains varying amounts of Anhydride) (CAS 105365-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4727-1G |
| cas | 105365-51-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 128.18 Pln | |
| TCI | 5g | 423.21 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(4-butoxyphenyl)boronic acid (CAS 105365-51-3) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-butoxyphenyl)boronic acid. InChIKey: QUPFQMXWFNJUNJ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-butoxyphenyl)boronic acid |
| InChIKey | QUPFQMXWFNJUNJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCC)(O)O |
Computed by PubChem (NCBI)