cas: 105365-51-3 — see every product listed under this CAS number, including other names
4-N-Butoxyphenylboronic acid, 98% (CAS 105365-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092736-1G |
| cas | 105365-51-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1190.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-butoxyphenyl)boronic acid (CAS 105365-51-3) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-butoxyphenyl)boronic acid. InChIKey: QUPFQMXWFNJUNJ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-butoxyphenyl)boronic acid |
| InChIKey | QUPFQMXWFNJUNJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCC)(O)O |
Computed by PubChem (NCBI)