CAS 2361678-04-6 is the registry number for {Thieno(3,2-b)pyridin-2-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Thieno[3,2-b]pyridin-2-ylmethanamine;dihydrochloride (CAS 2361678-04-6) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: thieno[3,2-b]pyridin-2-ylmethanamine;dihydrochloride. InChIKey: QPUWMRZSHKWLTF-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | thieno[3,2-b]pyridin-2-ylmethanamine;dihydrochloride |
| InChIKey | QPUWMRZSHKWLTF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(S2)CN)N=C1.Cl.Cl |
Computed by PubChem (NCBI)