CAS 2680540-24-1 is the registry number for Benzo(d)thiazol-5-ylmethanamine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1,3-benzothiazol-5-ylmethanamine;dihydrochloride (CAS 2680540-24-1) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: 1,3-benzothiazol-5-ylmethanamine;dihydrochloride. InChIKey: NBUVTLRWYXGNFW-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | 1,3-benzothiazol-5-ylmethanamine;dihydrochloride |
| InChIKey | NBUVTLRWYXGNFW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)N=CS2.Cl.Cl |
Computed by PubChem (NCBI)