cas: 859932-64-2 — see every product listed under this CAS number, including other names
4-CHLOROPHENYLGLYOXAL HYDRATE, 95%, 95% (CAS 859932-64-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IDUH-100mg |
| cas | 859932-64-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1254.80 Pln | |
| Chemat | 25g | 4235.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate (CAS 859932-64-2) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: JTOCXCVDVKZPEB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | JTOCXCVDVKZPEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)Cl.O |
Computed by PubChem (NCBI)