Products 1187238-15-8

CAS 1187238-15-8 is the registry number for 4-Chloro-3-(hydroxymethyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chloro-3-(hydroxymethyl)benzoic acid (CAS 1187238-15-8) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-3-(hydroxymethyl)benzoic acid. InChIKey: GMSTVHUHUQMNTD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO3
Molecular weight186.59 g/mol
IUPAC name4-chloro-3-(hydroxymethyl)benzoic acid
InChIKeyGMSTVHUHUQMNTD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)CO)Cl

Computed by PubChem (NCBI)