cas: 31139-03-4 — see every product listed under this CAS number, including other names
4-CYCLOHEXENE-1,2-DICARBOXYLIC ACID, 1-METHYL ESTER, (1R,2R)-REL-, 98% (CAS 31139-03-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504636-1G |
| cas | 31139-03-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1080.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid (CAS 31139-03-4) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: (1R,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid. InChIKey: MYYLMIDEMAPSGH-RNFRBKRXSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | (1R,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid |
| InChIKey | MYYLMIDEMAPSGH-RNFRBKRXSA-N |
| SMILES | COC(=O)[C@@H]1CC=CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)