Products 323196-38-9

CAS 323196-38-9 is the registry number for (1R,6R)-6-(Methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid (CAS 323196-38-9) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid. InChIKey: MYYLMIDEMAPSGH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O4
Molecular weight184.19 g/mol
IUPAC name6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid
InChIKeyMYYLMIDEMAPSGH-UHFFFAOYSA-N
SMILESCOC(=O)C1CC=CCC1C(=O)O

Computed by PubChem (NCBI)