CAS 88335-94-8 is the registry number for (1S,6R)-6-(Methoxycarbonyl)cyclohex-3-ene-1-carboxylic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1S,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid (CAS 88335-94-8) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: (1S,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid. InChIKey: MYYLMIDEMAPSGH-NKWVEPMBSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | (1S,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid |
| InChIKey | MYYLMIDEMAPSGH-NKWVEPMBSA-N |
| SMILES | COC(=O)[C@@H]1CC=CC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)