cas: 320-43-4 — see every product listed under this CAS number, including other names
4-Chloro-2-(trifluoromethyl)benzaldehyde, 98%, 98% (CAS 320-43-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I73B-1g |
| cas | 320-43-4 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 386.00 Pln | |
| Chemat | 100g | 1336.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-(trifluoromethyl)benzaldehyde (CAS 320-43-4) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzaldehyde. InChIKey: AHFINSWGYAZBOZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)benzaldehyde |
| InChIKey | AHFINSWGYAZBOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C=O |
Computed by PubChem (NCBI)