4-Chloro-2-ethoxyphenylboronic acid, 98%
cas: 850568-80-8 — see every product listed under this CAS number, including other names
4-Chloro-2-ethoxyphenylboronic acid, 98% (CAS 850568-80-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F219470-5G |
| cas | 850568-80-8 |
| size | 5g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 25g | 773.70 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 759.75 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 25g | 846.80 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 386.56 Pln | |
| BLDpharm | 25g | 814.18 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(4-chloro-2-ethoxyphenyl)boronic acid (CAS 850568-80-8) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (4-chloro-2-ethoxyphenyl)boronic acid. InChIKey: NIWJJDHZRLYASL-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (4-chloro-2-ethoxyphenyl)boronic acid |
| InChIKey | NIWJJDHZRLYASL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-2-ethoxyphenylboronic Acid (contains varying amounts of Anhydride), (4-chloro-2-ethoxyphenyl)boronic acid, 2-Ethoxy-4-chlorophenylboronic acid, 4-Chloro-2-ethoxybenzeneboronic acid, 4-Chloro-2-ethoxyphenylboronicacid, (4-chloro-2-ethoxy-phenyl)boronic Acid, (4-chloranyl-2-ethoxy-phenyl)boronic acid