Products 850568-80-8
CAS 850568-80-8 appears in our catalog under these names: 4–Chloro–2–ethoxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Chloro-2-ethoxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Chloro-2-ethoxyphenylboronic acid, 98%. Offered by: GLPBio, TCI, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 200mg, 25g, 250mg.
(4-chloro-2-ethoxyphenyl)boronic acid (CAS 850568-80-8) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (4-chloro-2-ethoxyphenyl)boronic acid. InChIKey: NIWJJDHZRLYASL-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (4-chloro-2-ethoxyphenyl)boronic acid |
| InChIKey | NIWJJDHZRLYASL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-2-ethoxyphenylboronic Acid (contains varying amounts of Anhydride), (4-chloro-2-ethoxyphenyl)boronic acid, 2-Ethoxy-4-chlorophenylboronic acid, 4-Chloro-2-ethoxybenzeneboronic acid, 4-Chloro-2-ethoxyphenylboronicacid, (4-chloro-2-ethoxy-phenyl)boronic Acid, (4-chloranyl-2-ethoxy-phenyl)boronic acid