cas: 394-39-8 — see every product listed under this CAS number, including other names
4-Chloro-2-fluorobenzoyl chloride (CAS 394-39-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009723-25G |
| cas | 394-39-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 758.08 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 331.15 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
4-chloro-2-fluorobenzoyl chloride (CAS 394-39-8) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 4-chloro-2-fluorobenzoyl chloride. InChIKey: PWHFJLCMUCFYRQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 4-chloro-2-fluorobenzoyl chloride |
| InChIKey | PWHFJLCMUCFYRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C(=O)Cl |
Computed by PubChem (NCBI)