cas: 184766-53-8 — see every product listed under this CAS number, including other names
4-Chloro-2-hydroxy-5-methoxybenzaldehyde, >97%, >97% (CAS 184766-53-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN07-100mg |
| cas | 184766-53-8 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1000.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2157.20 Pln | |
| Chemat | 5g | 4542.80 Pln | |
| Chemat | 10g | 5920.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-hydroxy-5-methoxybenzaldehyde (CAS 184766-53-8) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-2-hydroxy-5-methoxybenzaldehyde. InChIKey: HFYFXTVVEMAEOV-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-chloro-2-hydroxy-5-methoxybenzaldehyde |
| InChIKey | HFYFXTVVEMAEOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)O)Cl |
Computed by PubChem (NCBI)