cas: 57479-70-6 — see every product listed under this CAS number, including other names
4-Chloro-2-methoxybenzoic acid, 98%, 98% (CAS 57479-70-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L4J-10g |
| cas | 57479-70-6 |
| size | 10g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 280.40 Pln | |
| Chemat | 500g | 1219.20 Pln | |
| Chemat | 1kg | 2142.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-methoxybenzoic acid (CAS 57479-70-6) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-2-methoxybenzoic acid. InChIKey: UFEYMXHWIHFRBX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-chloro-2-methoxybenzoic acid |
| InChIKey | UFEYMXHWIHFRBX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)