cas: 327-78-6 — see every product listed under this CAS number, including other names
4-Chloro-3-(trifluoromethyl)phenyl Isocyanate, >98.0%(GC) (CAS 327-78-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2778-5G |
| cas | 327-78-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 400.12 Pln | |
| TCI | 25g | 1034.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-chloro-4-isocyanato-2-(trifluoromethyl)benzene (CAS 327-78-6) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene. InChIKey: NBJZEUQTGLSUOB-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | NBJZEUQTGLSUOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)