cas: 177787-25-6 — see every product listed under this CAS number, including other names
4-Chloro-3-fluorobenzoyl chloride, 95% (CAS 177787-25-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038158-1G |
| cas | 177787-25-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-3-fluorobenzoyl chloride (CAS 177787-25-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 4-chloro-3-fluorobenzoyl chloride. InChIKey: HJMGUKOEVZJUAO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 4-chloro-3-fluorobenzoyl chloride |
| InChIKey | HJMGUKOEVZJUAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)F)Cl |
Computed by PubChem (NCBI)