cas: 37777-68-7 — see every product listed under this CAS number, including other names
4-Chloro-3-nitrophenylacetic Acid, >98.0%(T) (CAS 37777-68-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C3347-1G |
| cas | 37777-68-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 546.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-(4-chloro-3-nitrophenyl)acetic acid (CAS 37777-68-7) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(4-chloro-3-nitrophenyl)acetic acid. InChIKey: WUXCECMNMNJYSC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(4-chloro-3-nitrophenyl)acetic acid |
| InChIKey | WUXCECMNMNJYSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)