cas: 37777-68-7 — see every product listed under this CAS number, including other names
4-Chloro-3-nitrophenylacetic acid, 98% (CAS 37777-68-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 5g, 1g, 25g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-2526-10g |
| cas | 37777-68-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| AmBeed | 10g | 493.15 Pln | |
| AmBeed | 5g | 323.89 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 591.48 Pln | |
| Fluorochem | 100g | 1658.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-(4-chloro-3-nitrophenyl)acetic acid (CAS 37777-68-7) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(4-chloro-3-nitrophenyl)acetic acid. InChIKey: WUXCECMNMNJYSC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(4-chloro-3-nitrophenyl)acetic acid |
| InChIKey | WUXCECMNMNJYSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)