cas: 40397-96-4 — see every product listed under this CAS number, including other names
4-Chloro-3-nitrophenylisocyanate, 99%(GC-MS),RG, 99%(GC-MS),RG (CAS 40397-96-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L6B-250mg |
| cas | 40397-96-4 |
| size | 250mg |
| availability | 65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 429.20 Pln |
| purity | 99%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-chloro-4-isocyanato-2-nitrobenzene (CAS 40397-96-4) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 1-chloro-4-isocyanato-2-nitrobenzene. InChIKey: ZCPHLSPLEGBTCZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 1-chloro-4-isocyanato-2-nitrobenzene |
| InChIKey | ZCPHLSPLEGBTCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)