cas: 40397-96-4 — see every product listed under this CAS number, including other names
4-chloro-3-nitrophenyl isocyanate (CAS 40397-96-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F518989-250MG |
| cas | 40397-96-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 25g | 2294.00 Pln |
| delivery time | 3-4 weeks |
|---|
1-chloro-4-isocyanato-2-nitrobenzene (CAS 40397-96-4) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 1-chloro-4-isocyanato-2-nitrobenzene. InChIKey: ZCPHLSPLEGBTCZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 1-chloro-4-isocyanato-2-nitrobenzene |
| InChIKey | ZCPHLSPLEGBTCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)