cas: 331761-46-7 — see every product listed under this CAS number, including other names
4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine, 97%, 97% (CAS 331761-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118H6P-100mg |
| cas | 331761-46-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 981.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine (CAS 331761-46-7) is a chemical compound with the molecular formula C12H6Cl2N2S and a molecular weight of 281.2 g/mol. IUPAC name: 4-chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine. InChIKey: QDMQHIKVIOWCGY-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2S |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 4-chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine |
| InChIKey | QDMQHIKVIOWCGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=NC=N3)Cl)Cl |
Computed by PubChem (NCBI)