Products 902765-47-3

CAS 902765-47-3 appears in our catalog under these names: 2,4-Dichloro-6-phenylthieno[2,3-d]pyrimidine, 95%, 2,4-Dichloro-6-phenylthieno(2,3-d)pyrimidine, 95+%, 2,4-Dichloro-6-phenylthieno[2,3-d]pyrimidine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-phenylthieno[2,3-d]pyrimidine (CAS 902765-47-3) is a chemical compound with the molecular formula C12H6Cl2N2S and a molecular weight of 281.2 g/mol. IUPAC name: 2,4-dichloro-6-phenylthieno[2,3-d]pyrimidine. InChIKey: RPPLNSDHURESPN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6Cl2N2S
Molecular weight281.2 g/mol
IUPAC name2,4-dichloro-6-phenylthieno[2,3-d]pyrimidine
InChIKeyRPPLNSDHURESPN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC3=C(S2)N=C(N=C3Cl)Cl

Computed by PubChem (NCBI)