CAS 1203681-45-1 is the registry number for 2-(2,6-Dichlorophenyl)thiazolo[5,4-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,6-dichlorophenyl)-[1,3]thiazolo[5,4-c]pyridine (CAS 1203681-45-1) is a chemical compound with the molecular formula C12H6Cl2N2S and a molecular weight of 281.2 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-[1,3]thiazolo[5,4-c]pyridine. InChIKey: WYEYRTQOAPZITC-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2S |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-[1,3]thiazolo[5,4-c]pyridine |
| InChIKey | WYEYRTQOAPZITC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NC3=C(S2)C=NC=C3)Cl |
Computed by PubChem (NCBI)