CAS 331761-46-7 appears in our catalog under these names: 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine, 95%, 4-Chloro-5-(4-chlorophenyl)thieno¬2,3-d|pyrimidine, 96% , 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine, 97%, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine (CAS 331761-46-7) is a chemical compound with the molecular formula C12H6Cl2N2S and a molecular weight of 281.2 g/mol. IUPAC name: 4-chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine. InChIKey: QDMQHIKVIOWCGY-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2S |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 4-chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine |
| InChIKey | QDMQHIKVIOWCGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=NC=N3)Cl)Cl |
Computed by PubChem (NCBI)