Products 76872-27-0

CAS 76872-27-0 appears in our catalog under these names: 2,4-Dichloro-5-phenylthieno[2,3-d]pyrimidine, 98%, 98%, 2,4-Dichloro-5-phenylthieno[2,3-d]pyrimidine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-phenylthieno[2,3-d]pyrimidine (CAS 76872-27-0) is a chemical compound with the molecular formula C12H6Cl2N2S and a molecular weight of 281.2 g/mol. IUPAC name: 2,4-dichloro-5-phenylthieno[2,3-d]pyrimidine. InChIKey: BEWMVQBIACDTCL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6Cl2N2S
Molecular weight281.2 g/mol
IUPAC name2,4-dichloro-5-phenylthieno[2,3-d]pyrimidine
InChIKeyBEWMVQBIACDTCL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CSC3=C2C(=NC(=N3)Cl)Cl

Computed by PubChem (NCBI)