Products 827614-30-2
CAS 827614-30-2 appears in our catalog under these names: 4-Chloro-7-(4-chlorophenyl)thieno[3,2-d]pyrimidine, 95%, 4-Chloro-7-(4-chlorophenyl)thieno[3,2-d]pyrimidine. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
4-chloro-7-(4-chlorophenyl)thieno[3,2-d]pyrimidine (CAS 827614-30-2) is a chemical compound with the molecular formula C12H6Cl2N2S and a molecular weight of 281.2 g/mol. IUPAC name: 4-chloro-7-(4-chlorophenyl)thieno[3,2-d]pyrimidine. InChIKey: MATKJCHDNFGCKJ-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2S |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 4-chloro-7-(4-chlorophenyl)thieno[3,2-d]pyrimidine |
| InChIKey | MATKJCHDNFGCKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2N=CN=C3Cl)Cl |
Computed by PubChem (NCBI)