cas: 907958-42-3 — see every product listed under this CAS number, including other names
4-Chloro-5-nitro-1H-indazole 97+% (CAS 907958-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231103-100mg |
| cas | 907958-42-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1722.06 Pln | |
| Ambeed | 10g | 3307.38 Pln | |
| Ambeed | 25g | 6539.19 Pln | |
| Ambeed | 100g | 20768.06 Pln |
| purity | 97+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A231103 |
4-chloro-5-nitro-1H-indazole (CAS 907958-42-3) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 4-chloro-5-nitro-1H-indazole. InChIKey: AXZCWGUWGPLXOR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 4-chloro-5-nitro-1H-indazole |
| InChIKey | AXZCWGUWGPLXOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)