4-Chloro-7,8-dimethoxyquinazoline, 97%
cas: 211320-77-3 — see every product listed under this CAS number, including other names
4-Chloro-7,8-dimethoxyquinazoline, 97% (CAS 211320-77-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A810539-100mg |
| cas | 211320-77-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1505.12 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1613.90 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1549.47 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 5g | 5272.12 Pln | |
| Fluorochem | 10g | 9161.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-7,8-dimethoxyquinazoline (CAS 211320-77-3) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 4-chloro-7,8-dimethoxyquinazoline. InChIKey: RZPKBBLAXBUADI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-chloro-7,8-dimethoxyquinazoline |
| InChIKey | RZPKBBLAXBUADI-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=NC=N2)Cl)OC |
Computed by PubChem (NCBI)