cas: 159768-48-6 — see every product listed under this CAS number, including other names
4-Chloro-7-Fluoro-6-Methoxy-quinazoline, 98% (CAS 159768-48-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A395519-10g |
| cas | 159768-48-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 26494.09 Pln | |
| AmBeed | 1g | 8572.06 Pln | |
| AmBeed | 5g | 15921.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-chloro-7-fluoro-6-methoxyquinazoline (CAS 159768-48-6) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 4-chloro-7-fluoro-6-methoxyquinazoline. InChIKey: XVFCYYAFOCEJSI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 4-chloro-7-fluoro-6-methoxyquinazoline |
| InChIKey | XVFCYYAFOCEJSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)Cl)F |
Computed by PubChem (NCBI)