cas: 943780-24-3 — see every product listed under this CAS number, including other names
4-Chloro-7-isopropylquinazoline, ≥95%, ≥95% (CAS 943780-24-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMBP-250mg |
| cas | 943780-24-3 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1821.20 Pln | |
| Chemat | 1g | 4106.00 Pln | |
| Chemat | 5g | 11090.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-chloro-7-propan-2-ylquinazoline (CAS 943780-24-3) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 4-chloro-7-propan-2-ylquinazoline. InChIKey: ZRBXNJFLLJEJAN-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 4-chloro-7-propan-2-ylquinazoline |
| InChIKey | ZRBXNJFLLJEJAN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)