cas: 35212-95-4 — see every product listed under this CAS number, including other names
4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester, 98% (CAS 35212-95-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F316952-1G |
| cas | 35212-95-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 638.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-chloro-1-benzothiophene-2-carboxylate (CAS 35212-95-4) is a chemical compound with the molecular formula C10H7ClO2S and a molecular weight of 226.68 g/mol. IUPAC name: methyl 4-chloro-1-benzothiophene-2-carboxylate. InChIKey: CKXPDFHEOUVFRD-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | methyl 4-chloro-1-benzothiophene-2-carboxylate |
| InChIKey | CKXPDFHEOUVFRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=CC=C2Cl |
Computed by PubChem (NCBI)