Products 752135-41-4
CAS 752135-41-4 appears in our catalog under these names: 7–Chloro–3–methylbenzo(b)thiophene–2–carboxylic acid, 7-Chloro-3-methylbenzo(B)thiophene-2-carboxylic Acid, 7-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid 98%, 7-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid, 98%, 98%, 7-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 5g, 250mg, 1g.
7-chloro-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 752135-41-4) is a chemical compound with the molecular formula C10H7ClO2S and a molecular weight of 226.68 g/mol. IUPAC name: 7-chloro-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: JXEJPBOIKNNLQX-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 7-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | JXEJPBOIKNNLQX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)