CAS 50451-84-8 appears in our catalog under these names: 5–Chloro–3–methylbenzo(b)thiophene–2–carboxylic acid, 5-Chloro-3-methyl-1-benzothiophene-2-carboxylic acid, 95% , 5-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid 90%, 5-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid, 90%, 90%, 5-Chloro-3-methyl-1-benzothiophene-2-carboxylic acid, 98%. Offered by: GLPBio, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250MG, 1g, 5g.
5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 50451-84-8) is a chemical compound with the molecular formula C10H7ClO2S and a molecular weight of 226.68 g/mol. IUPAC name: 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: KEYCXZNZFABITO-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | KEYCXZNZFABITO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)