CAS 85-46-1 appears in our catalog under these names: 1-Naphthalenesulfonyl chloride, 97%, 1-Naphthalenesulfonyl chloride, 98%, 1-Naphthalenesulfonyl Chloride, >98.0%(T). Offered by: Combi-blocks, Chemat Brand, Sigma-Aldrich, Fluorochem, TCI. Available pack sizes: 1g, 25g, 100g, 10g, 5g, on request, 500g.
Naphthalene-1-sulfonyl chloride (CAS 85-46-1) is a chemical compound with the molecular formula C10H7ClO2S and a molecular weight of 226.68 g/mol. IUPAC name: naphthalene-1-sulfonyl chloride. InChIKey: DASJFYAPNPUBGG-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | naphthalene-1-sulfonyl chloride |
| InChIKey | DASJFYAPNPUBGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)