CAS 34576-96-0 appears in our catalog under these names: 3–Chloro–6–methylbenzo(b)thiophene–2–carboxylic acid, 3-Chloro-6-methylbenzo[b]thiophene-2-carboxylic acid 95%, 3-Chloro-6-methyl-benzo[b]thiophene-2-carboxylic acid, 97%, 3-Chloro-6-methylbenzo[b]thiophene-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g.
3-chloro-6-methyl-1-benzothiophene-2-carboxylic acid (CAS 34576-96-0) is a chemical compound with the molecular formula C10H7ClO2S and a molecular weight of 226.68 g/mol. IUPAC name: 3-chloro-6-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: KWGVHWHFCFSQAZ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 3-chloro-6-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | KWGVHWHFCFSQAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)