Products 66490-32-2
CAS 66490-32-2 appears in our catalog under these names: 6-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid, 95%, 6-chloro-3-methylbenzo(b)thiophene-2-carboxylic acid, 6-Chloro-3-methylbenzo[b]thiophene-2-carboxylic acid, 97%, 97%, 6-CHLORO-3-METHYLBENZO[B]THIOPHENE-2-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg, 10g.
6-chloro-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 66490-32-2) is a chemical compound with the molecular formula C10H7ClO2S and a molecular weight of 226.68 g/mol. IUPAC name: 6-chloro-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: QEINRGCVGFKPIW-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 6-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | QEINRGCVGFKPIW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)