cas: 4722-94-5 — see every product listed under this CAS number, including other names
4-Chloropyridine-2,6-dicarboxylic acid 97% (CAS 4722-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A265318-250mg |
| cas | 4722-94-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 859.88 Pln | |
| Ambeed | 100g | 2289.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A265318 |
4-chloropyridine-2,6-dicarboxylic acid (CAS 4722-94-5) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 4-chloropyridine-2,6-dicarboxylic acid. InChIKey: IYUMNONNHYADBU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 4-chloropyridine-2,6-dicarboxylic acid |
| InChIKey | IYUMNONNHYADBU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)