Products 220542-03-0
CAS 220542-03-0 appears in our catalog under these names: 4-Cyano-3-hydroxybenzoic acid, 4-Cyano-3-hydroxybenzoic acid, 95+%, 95+%, 4-Cyano-3-hydroxybenzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
4-cyano-3-hydroxybenzoic acid (CAS 220542-03-0) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-cyano-3-hydroxybenzoic acid. InChIKey: PAVYLTWYIJWKFM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-cyano-3-hydroxybenzoic acid |
| InChIKey | PAVYLTWYIJWKFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)C#N |
Computed by PubChem (NCBI)