cas: 91902-58-8 — see every product listed under this CAS number, including other names
4-Ethyl-1-naphthoic acid, 95%, 95% (CAS 91902-58-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUDS-250mg |
| cas | 91902-58-8 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 352.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-ethylnaphthalene-1-carboxylic acid (CAS 91902-58-8) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 4-ethylnaphthalene-1-carboxylic acid. InChIKey: PLFCGQDMWZGHOQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-ethylnaphthalene-1-carboxylic acid |
| InChIKey | PLFCGQDMWZGHOQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C2=CC=CC=C12)C(=O)O |
Computed by PubChem (NCBI)