cas: 91902-58-8 — see every product listed under this CAS number, including other names
4-Ethyl-1-naphthoic acid, 97% (CAS 91902-58-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210402-250MG |
| cas | 91902-58-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 544.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-ethylnaphthalene-1-carboxylic acid (CAS 91902-58-8) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 4-ethylnaphthalene-1-carboxylic acid. InChIKey: PLFCGQDMWZGHOQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-ethylnaphthalene-1-carboxylic acid |
| InChIKey | PLFCGQDMWZGHOQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C2=CC=CC=C12)C(=O)O |
Computed by PubChem (NCBI)