cas: 1072946-10-1 — see every product listed under this CAS number, including other names
4-Fluoro-2,5-dimethylphenylboronic acid (CAS 1072946-10-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622999-1G |
| cas | 1072946-10-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1263.11 Pln | |
| Fluorochem | 5g | 3652.90 Pln |
| delivery time | 3-4 weeks |
|---|
(4-fluoro-2,5-dimethylphenyl)boronic acid (CAS 1072946-10-1) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-fluoro-2,5-dimethylphenyl)boronic acid. InChIKey: VZEWNOKICGAJPJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (4-fluoro-2,5-dimethylphenyl)boronic acid |
| InChIKey | VZEWNOKICGAJPJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)C)(O)O |
Computed by PubChem (NCBI)